C17H19IN2O3S — CID 22299913
2-[(2,4-dimethylphenyl)methylsulfonylamino]-N-(4-iodophenyl)acetamide (PubChem CID 22299913) has the molecular formula C17H19IN2O3S and a molecular weight of 458.32 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)methylsulfonylamino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(2,4-dimethylphenyl)methylsulfonylamino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 22299913 |
| Molecular Formula | C17H19IN2O3S |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)methylsulfonylamino]-N-(4-iodophenyl)acetamide |
| SMILES | Cc1ccc(CS(=O)(=O)NCC(=O)Nc2ccc(I)cc2)c(C)c1 |
| InChI | InChI=1S/C17H19IN2O3S/c1-12-3-4-14(13(2)9-12)11-24(22,23)19-10-17(21)20-16-7-5-15(18)6-8-16/h3-9,19H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | CMQSBNILCXTJNR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|