C14H20N2O3 — CID 22308113
(NZ)-N-[1-(3,4-dimethoxyphenyl)-3-methylpiperidin-4-ylidene]hydroxylamine (PubChem CID 22308113) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (NZ)-N-[1-(3,4-dimethoxyphenyl)-3-methylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(3,4-dimethoxyphenyl)-3-methylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 22308113 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (NZ)-N-[1-(3,4-dimethoxyphenyl)-3-methylpiperidin-4-ylidene]hydroxylamine |
| SMILES | COc1ccc(N2CC/C(=N/O)C(C)C2)cc1OC |
| InChI | InChI=1S/C14H20N2O3/c1-10-9-16(7-6-12(10)15-17)11-4-5-13(18-2)14(8-11)19-3/h4-5,8,10,17H,6-7,9H2,1-3H3/b15-12- |
| InChIKey | WJNAVRAOMHSUIJ-QINSGFPZSA-N |
| XLogP | 2.38 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|