C13H22NO4+ — CID 2231806
2-(2,6-dimethoxyphenoxy)ethyl-[(2S)-2-hydroxypropyl]azanium (PubChem CID 2231806) has the molecular formula C13H22NO4+ and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)ethyl-[(2S)-2-hydroxypropyl]azanium.
| Compound Name | 2-(2,6-dimethoxyphenoxy)ethyl-[(2S)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 2231806 |
| Molecular Formula | C13H22NO4+ |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)ethyl-[(2S)-2-hydroxypropyl]azanium |
| SMILES | COc1cccc(OC)c1OCC[NH2+]C[C@H](C)O |
| InChI | InChI=1S/C13H21NO4/c1-10(15)9-14-7-8-18-13-11(16-2)5-4-6-12(13)17-3/h4-6,10,14-15H,7-9H2,1-3H3/p+1/t10-/m0/s1 |
| InChIKey | LFYLJJJKCKFXFG-JTQLQIEISA-O |
| XLogP | 0.03 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|