C14H24NO4+ — CID 2233166
3-(2,6-dimethoxyphenoxy)propyl-[(2S)-2-hydroxypropyl]azanium (PubChem CID 2233166) has the molecular formula C14H24NO4+ and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenoxy)propyl-[(2S)-2-hydroxypropyl]azanium.
| Compound Name | 3-(2,6-dimethoxyphenoxy)propyl-[(2S)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 2233166 |
| Molecular Formula | C14H24NO4+ |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-(2,6-dimethoxyphenoxy)propyl-[(2S)-2-hydroxypropyl]azanium |
| SMILES | COc1cccc(OC)c1OCCC[NH2+]C[C@H](C)O |
| InChI | InChI=1S/C14H23NO4/c1-11(16)10-15-8-5-9-19-14-12(17-2)6-4-7-13(14)18-3/h4,6-7,11,15-16H,5,8-10H2,1-3H3/p+1/t11-/m0/s1 |
| InChIKey | KYTHIKNEZDLFAM-NSHDSACASA-O |
| XLogP | 0.42 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|