C26H33F2N7O — CID 22324145
4-[2-[[4-[3-(3,4-difluorophenyl)propyl-methylamino]-6-piperazin-1-yl-1,3,5-triazin-2-yl]methylamino]ethyl]phenol (PubChem CID 22324145) has the molecular formula C26H33F2N7O and a molecular weight of 497.59 g/mol. Its IUPAC name is 4-[2-[[4-[3-(3,4-difluorophenyl)propyl-methylamino]-6-piperazin-1-yl-1,3,5-triazin-2-yl]methylamino]ethyl]phenol.
| Compound Name | 4-[2-[[4-[3-(3,4-difluorophenyl)propyl-methylamino]-6-piperazin-1-yl-1,3,5-triazin-2-yl]methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 22324145 |
| Molecular Formula | C26H33F2N7O |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 4-[2-[[4-[3-(3,4-difluorophenyl)propyl-methylamino]-6-piperazin-1-yl-1,3,5-triazin-2-yl]methylamino]ethyl]phenol |
| SMILES | CN(CCCc1ccc(F)c(F)c1)c1nc(CNCCc2ccc(O)cc2)nc(N2CCNCC2)n1 |
| InChI | InChI=1S/C26H33F2N7O/c1-34(14-2-3-20-6-9-22(27)23(28)17-20)25-31-24(32-26(33-25)35-15-12-29-13-16-35)18-30-11-10-19-4-7-21(36)8-5-19/h4-9,17,29-30,36H,2-3,10-16,18H2,1H3 |
| InChIKey | KBDZDGYCOIYJTN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|