C25H28N4O5 — CID 22330125
ethyl 3-[3-[4-(furan-3-yl)-2-nitroanilino]phenyl]-3-piperazin-1-ylpropanoate (PubChem CID 22330125) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is ethyl 3-[3-[4-(furan-3-yl)-2-nitroanilino]phenyl]-3-piperazin-1-ylpropanoate.
| Compound Name | ethyl 3-[3-[4-(furan-3-yl)-2-nitroanilino]phenyl]-3-piperazin-1-ylpropanoate |
|---|---|
| PubChem CID | 22330125 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | ethyl 3-[3-[4-(furan-3-yl)-2-nitroanilino]phenyl]-3-piperazin-1-ylpropanoate |
| SMILES | CCOC(=O)CC(c1cccc(Nc2ccc(-c3ccoc3)cc2[N+](=O)[O-])c1)N1CCNCC1 |
| InChI | InChI=1S/C25H28N4O5/c1-2-34-25(30)16-23(28-11-9-26-10-12-28)19-4-3-5-21(14-19)27-22-7-6-18(15-24(22)29(31)32)20-8-13-33-17-20/h3-8,13-15,17,23,26-27H,2,9-12,16H2,1H3 |
| InChIKey | MNKGSVROLWFJLE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|