C21H22Cl2N2O — CID 22330359
N-(3,4-dichlorophenyl)-2,2,4,6,8-pentamethylquinoline-1-carboxamide (PubChem CID 22330359) has the molecular formula C21H22Cl2N2O and a molecular weight of 389.33 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2,2,4,6,8-pentamethylquinoline-1-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-2,2,4,6,8-pentamethylquinoline-1-carboxamide |
|---|---|
| PubChem CID | 22330359 |
| Molecular Formula | C21H22Cl2N2O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2,2,4,6,8-pentamethylquinoline-1-carboxamide |
| SMILES | CC1=CC(C)(C)N(C(=O)Nc2ccc(Cl)c(Cl)c2)c2c(C)cc(C)cc21 |
| InChI | InChI=1S/C21H22Cl2N2O/c1-12-8-13(2)19-16(9-12)14(3)11-21(4,5)25(19)20(26)24-15-6-7-17(22)18(23)10-15/h6-11H,1-5H3,(H,24,26) |
| InChIKey | ANWFSXCVGMFVHW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |