C9H10N6O4 — CID 22332290
4-[4-nitro-5-(1,3,4-oxadiazol-2-yl)-1H-pyrazol-3-yl]morpholine (PubChem CID 22332290) has the molecular formula C9H10N6O4 and a molecular weight of 266.22 g/mol. Its IUPAC name is 4-[4-nitro-5-(1,3,4-oxadiazol-2-yl)-1H-pyrazol-3-yl]morpholine.
| Compound Name | 4-[4-nitro-5-(1,3,4-oxadiazol-2-yl)-1H-pyrazol-3-yl]morpholine |
|---|---|
| PubChem CID | 22332290 |
| Molecular Formula | C9H10N6O4 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-[4-nitro-5-(1,3,4-oxadiazol-2-yl)-1H-pyrazol-3-yl]morpholine |
| SMILES | O=[N+]([O-])c1c(N2CCOCC2)n[nH]c1-c1nnco1 |
| InChI | InChI=1S/C9H10N6O4/c16-15(17)7-6(9-13-10-5-19-9)11-12-8(7)14-1-3-18-4-2-14/h5H,1-4H2,(H,11,12) |
| InChIKey | ZHUAMZACUCKXOA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|