C18H24N4O3S — CID 22344412
N-[3-(2-butyl-5-oxidoimidazo[4,5-c]quinolin-5-ium-1-yl)propyl]methanesulfonamide (PubChem CID 22344412) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[3-(2-butyl-5-oxidoimidazo[4,5-c]quinolin-5-ium-1-yl)propyl]methanesulfonamide.
| Compound Name | N-[3-(2-butyl-5-oxidoimidazo[4,5-c]quinolin-5-ium-1-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 22344412 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[3-(2-butyl-5-oxidoimidazo[4,5-c]quinolin-5-ium-1-yl)propyl]methanesulfonamide |
| SMILES | CCCCc1nc2c[n+]([O-])c3ccccc3c2n1CCCNS(C)(=O)=O |
| InChI | InChI=1S/C18H24N4O3S/c1-3-4-10-17-20-15-13-22(23)16-9-6-5-8-14(16)18(15)21(17)12-7-11-19-26(2,24)25/h5-6,8-9,13,19H,3-4,7,10-12H2,1-2H3 |
| InChIKey | CNDBXITWFDAPKY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|