C10H13F3O5 — CID 22348613
2-[4,6-dihydroxy-2-methyl-2-(trifluoromethyl)oxan-4-yl]prop-2-enoic acid (PubChem CID 22348613) has the molecular formula C10H13F3O5 and a molecular weight of 270.20 g/mol. Its IUPAC name is 2-[4,6-dihydroxy-2-methyl-2-(trifluoromethyl)oxan-4-yl]prop-2-enoic acid.
| Compound Name | 2-[4,6-dihydroxy-2-methyl-2-(trifluoromethyl)oxan-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22348613 |
| Molecular Formula | C10H13F3O5 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-[4,6-dihydroxy-2-methyl-2-(trifluoromethyl)oxan-4-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1(O)CC(O)OC(C)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H13F3O5/c1-5(7(15)16)9(17)3-6(14)18-8(2,4-9)10(11,12)13/h6,14,17H,1,3-4H2,2H3,(H,15,16) |
| InChIKey | AUGJVQIDRHLOPU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|