C9H9F9O3 — CID 98047882
(2R,4R,6R)-6-methyl-2,4,6-tris(trifluoromethyl)oxane-2,4-diol (PubChem CID 98047882) has the molecular formula C9H9F9O3 and a molecular weight of 336.15 g/mol. Its IUPAC name is (2R,4R,6R)-6-methyl-2,4,6-tris(trifluoromethyl)oxane-2,4-diol.
| Compound Name | (2R,4R,6R)-6-methyl-2,4,6-tris(trifluoromethyl)oxane-2,4-diol |
|---|---|
| PubChem CID | 98047882 |
| Molecular Formula | C9H9F9O3 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (2R,4R,6R)-6-methyl-2,4,6-tris(trifluoromethyl)oxane-2,4-diol |
| SMILES | C[C@]1(C(F)(F)F)C[C@](O)(C(F)(F)F)C[C@](O)(C(F)(F)F)O1 |
| InChI | InChI=1S/C9H9F9O3/c1-4(7(10,11)12)2-5(19,8(13,14)15)3-6(20,21-4)9(16,17)18/h19-20H,2-3H2,1H3/t4-,5-,6-/m1/s1 |
| InChIKey | ZHZPKMZKYBQGKG-HSUXUTPPSA-N |
| XLogP | 2.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |