About CID 22359712
CID 22359712 (PubChem CID 22359712) has the molecular formula C29H30F2NSi
and a molecular weight of 458.65 g/mol.
Molecular Properties
| Compound Name | CID 22359712 |
| PubChem CID | 22359712 |
| Molecular Formula | C29H30F2NSi |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC(c2ccc(-c3ccccc3)c(-c3cc(F)c(C#N)c(F)c3)c2)CC1 |
| InChI | InChI=1S/C29H30F2NSi/c1-2-3-7-14-33-15-12-21(13-16-33)23-10-11-25(22-8-5-4-6-9-22)26(17-23)24-18-28(30)27(20-32)29(31)19-24/h4-6,8-11,17-19,21H,2-3,7,12-16H2,1H3 |
| InChIKey | UAWNIFYIFYDMNG-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22359712 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22359712?
The IUPAC name of CID 22359712 (CID 22359712) is not available.
What is the SMILES notation for CID 22359712?
The canonical SMILES for CID 22359712 is CCCCC[Si]1CCC(c2ccc(-c3ccccc3)c(-c3cc(F)c(C#N)c(F)c3)c2)CC1.
What is the InChIKey of CID 22359712?
The InChIKey is UAWNIFYIFYDMNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30F2NSi/c1-2-3-7-14-33-15-12-21(13-16-33)23-10-11-25(22-8-5-4-6-9-22)26(17-23)24-18-28(30)27(20-32)29(31)19-24/h4-6,8-11,17-19,21H,2-3,7,12-16H2,1H3.
What are the key properties of CID 22359712?
CID 22359712 has a molecular weight of 458.65 g/mol, XLogP of 8.73, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22359712 is sourced from PubChem (CID 22359712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).