C12H14O5S — CID 22367118
1-[2-(1,3-benzodioxol-5-yl)ethylsulfonyl]propan-2-one (PubChem CID 22367118) has the molecular formula C12H14O5S and a molecular weight of 270.31 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethylsulfonyl]propan-2-one.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethylsulfonyl]propan-2-one |
|---|---|
| PubChem CID | 22367118 |
| Molecular Formula | C12H14O5S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethylsulfonyl]propan-2-one |
| SMILES | CC(=O)CS(=O)(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H14O5S/c1-9(13)7-18(14,15)5-4-10-2-3-11-12(6-10)17-8-16-11/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | WMMDCCIDQQMUMP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |