C28H22ClN3O3S — CID 22388440
N-(benzenesulfonyl)-1-[(2-chloro-4-phenylphenyl)methyl]-3-methylindazole-6-carboxamide (PubChem CID 22388440) has the molecular formula C28H22ClN3O3S and a molecular weight of 516.02 g/mol. Its IUPAC name is N-(benzenesulfonyl)-1-[(2-chloro-4-phenylphenyl)methyl]-3-methylindazole-6-carboxamide.
| Compound Name | N-(benzenesulfonyl)-1-[(2-chloro-4-phenylphenyl)methyl]-3-methylindazole-6-carboxamide |
|---|---|
| PubChem CID | 22388440 |
| Molecular Formula | C28H22ClN3O3S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | N-(benzenesulfonyl)-1-[(2-chloro-4-phenylphenyl)methyl]-3-methylindazole-6-carboxamide |
| SMILES | Cc1nn(Cc2ccc(-c3ccccc3)cc2Cl)c2cc(C(=O)NS(=O)(=O)c3ccccc3)ccc12 |
| InChI | InChI=1S/C28H22ClN3O3S/c1-19-25-15-14-22(28(33)31-36(34,35)24-10-6-3-7-11-24)17-27(25)32(30-19)18-23-13-12-21(16-26(23)29)20-8-4-2-5-9-20/h2-17H,18H2,1H3,(H,31,33) |
| InChIKey | MQSGJOPSVLFGIZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |