C17H24F2O3 — CID 22406466
(2Z,4E)-5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dien-1-ol (PubChem CID 22406466) has the molecular formula C17H24F2O3 and a molecular weight of 314.37 g/mol. Its IUPAC name is (2Z,4E)-5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dien-1-ol.
| Compound Name | (2Z,4E)-5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 22406466 |
| Molecular Formula | C17H24F2O3 |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2Z,4E)-5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dien-1-ol |
| SMILES | CC(=C/CO)/C=C/C1C(C(F)F)=CC2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C17H24F2O3/c1-12(6-7-20)4-5-14-13(15(18)19)10-17(11-16(14,2)3)21-8-9-22-17/h4-6,10,14-15,20H,7-9,11H2,1-3H3/b5-4+,12-6- |
| InChIKey | XHHZQIVCHMROKH-VULOCEMHSA-N |
| XLogP | 3.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|