C22H32N2O2 — CID 2240744
3-[[(2S)-2-ethylpiperidin-1-yl]methyl]-2-methyl-6-(2-methylpropoxy)-1H-quinolin-4-one (PubChem CID 2240744) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 3-[[(2S)-2-ethylpiperidin-1-yl]methyl]-2-methyl-6-(2-methylpropoxy)-1H-quinolin-4-one.
| Compound Name | 3-[[(2S)-2-ethylpiperidin-1-yl]methyl]-2-methyl-6-(2-methylpropoxy)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 2240744 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 3-[[(2S)-2-ethylpiperidin-1-yl]methyl]-2-methyl-6-(2-methylpropoxy)-1H-quinolin-4-one |
| SMILES | CC[C@H]1CCCCN1Cc1c(C)[nH]c2ccc(OCC(C)C)cc2c1=O |
| InChI | InChI=1S/C22H32N2O2/c1-5-17-8-6-7-11-24(17)13-20-16(4)23-21-10-9-18(26-14-15(2)3)12-19(21)22(20)25/h9-10,12,15,17H,5-8,11,13-14H2,1-4H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | XKLMCFBOUQZMRQ-KRWDZBQOSA-N |
| XLogP | 4.64 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |