C17H15ClFN5O — CID 22423794
5-amino-N-benzyl-1-[(2-chloro-4-fluorophenyl)methyl]triazole-4-carboxamide (PubChem CID 22423794) has the molecular formula C17H15ClFN5O and a molecular weight of 359.79 g/mol. Its IUPAC name is 5-amino-N-benzyl-1-[(2-chloro-4-fluorophenyl)methyl]triazole-4-carboxamide.
| Compound Name | 5-amino-N-benzyl-1-[(2-chloro-4-fluorophenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 22423794 |
| Molecular Formula | C17H15ClFN5O |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 5-amino-N-benzyl-1-[(2-chloro-4-fluorophenyl)methyl]triazole-4-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccccc2)nnn1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H15ClFN5O/c18-14-8-13(19)7-6-12(14)10-24-16(20)15(22-23-24)17(25)21-9-11-4-2-1-3-5-11/h1-8H,9-10,20H2,(H,21,25) |
| InChIKey | KFNRNPAKXWRBGN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |