C25H30Si — CID 22438235
(2,3-dibutylcyclopenta-2,4-dien-1-ylidene)-diphenylsilane (PubChem CID 22438235) has the molecular formula C25H30Si and a molecular weight of 358.60 g/mol. Its IUPAC name is (2,3-dibutylcyclopenta-2,4-dien-1-ylidene)-diphenylsilane.
| Compound Name | (2,3-dibutylcyclopenta-2,4-dien-1-ylidene)-diphenylsilane |
|---|---|
| PubChem CID | 22438235 |
| Molecular Formula | C25H30Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (2,3-dibutylcyclopenta-2,4-dien-1-ylidene)-diphenylsilane |
| SMILES | CCCCC1=C(CCCC)C(=[Si](c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C25H30Si/c1-3-5-13-21-19-20-25(24(21)18-6-4-2)26(22-14-9-7-10-15-22)23-16-11-8-12-17-23/h7-12,14-17,19-20H,3-6,13,18H2,1-2H3 |
| InChIKey | NGGOVTNOFUGQBA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|