C31H25N5O2 — CID 22448634
4-(3-imidazol-1-ylphenyl)-7-(4-oxopiperidin-1-yl)-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 22448634) has the molecular formula C31H25N5O2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 4-(3-imidazol-1-ylphenyl)-7-(4-oxopiperidin-1-yl)-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 4-(3-imidazol-1-ylphenyl)-7-(4-oxopiperidin-1-yl)-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 22448634 |
| Molecular Formula | C31H25N5O2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 4-(3-imidazol-1-ylphenyl)-7-(4-oxopiperidin-1-yl)-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | O=C1CCN(c2cc3c(cc2C#Cc2ccccc2)NC(=O)CC(c2cccc(-n4ccnc4)c2)=N3)CC1 |
| InChI | InChI=1S/C31H25N5O2/c37-26-11-14-35(15-12-26)30-19-29-28(18-24(30)10-9-22-5-2-1-3-6-22)34-31(38)20-27(33-29)23-7-4-8-25(17-23)36-16-13-32-21-36/h1-8,13,16-19,21H,11-12,14-15,20H2,(H,34,38) |
| InChIKey | NXDQSYYEQJJESV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|