C27H36O12 — CID 22460255
tris[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,3,5-tricarboxylate (PubChem CID 22460255) has the molecular formula C27H36O12 and a molecular weight of 552.57 g/mol. Its IUPAC name is tris[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,3,5-tricarboxylate.
| Compound Name | tris[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 22460255 |
| Molecular Formula | C27H36O12 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | tris[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,3,5-tricarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CC(C(=O)OCCOC(=O)C(=C)C)CC(C(=O)OCCOC(=O)C(=C)C)C1 |
| InChI | InChI=1S/C27H36O12/c1-16(2)22(28)34-7-10-37-25(31)19-13-20(26(32)38-11-8-35-23(29)17(3)4)15-21(14-19)27(33)39-12-9-36-24(30)18(5)6/h19-21H,1,3,5,7-15H2,2,4,6H3 |
| InChIKey | IEHQWSOFWLZWQE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|