C15H20O8 — CID 22460259
5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]cyclohexane-1,3-dicarboxylic acid (PubChem CID 22460259) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]cyclohexane-1,3-dicarboxylic acid.
| Compound Name | 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]cyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22460259 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]cyclohexane-1,3-dicarboxylic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CC(C(=O)O)CC(C(=O)O)C1 |
| InChI | InChI=1S/C15H20O8/c1-8(2)14(20)22-3-4-23-15(21)11-6-9(12(16)17)5-10(7-11)13(18)19/h9-11H,1,3-7H2,2H3,(H,16,17)(H,18,19) |
| InChIKey | WWJBQMNJGHHIEW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|