C11H12F3NO3S — CID 22464517
3-(2-ethylsulfonylphenyl)-N,2,2-trifluoropropanamide (PubChem CID 22464517) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is 3-(2-ethylsulfonylphenyl)-N,2,2-trifluoropropanamide.
| Compound Name | 3-(2-ethylsulfonylphenyl)-N,2,2-trifluoropropanamide |
|---|---|
| PubChem CID | 22464517 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-(2-ethylsulfonylphenyl)-N,2,2-trifluoropropanamide |
| SMILES | CCS(=O)(=O)c1ccccc1CC(F)(F)C(=O)NF |
| InChI | InChI=1S/C11H12F3NO3S/c1-2-19(17,18)9-6-4-3-5-8(9)7-11(12,13)10(16)15-14/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | DVLZPQWFRNUHRY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|