C17H23O8P — CID 22466181
2-[[benzyl(propanoyloxymethoxy)phosphoryl]methyl]pentanedioic acid (PubChem CID 22466181) has the molecular formula C17H23O8P and a molecular weight of 386.34 g/mol. Its IUPAC name is 2-[[benzyl(propanoyloxymethoxy)phosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[benzyl(propanoyloxymethoxy)phosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 22466181 |
| Molecular Formula | C17H23O8P |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[[benzyl(propanoyloxymethoxy)phosphoryl]methyl]pentanedioic acid |
| SMILES | CCC(=O)OCOP(=O)(Cc1ccccc1)CC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H23O8P/c1-2-16(20)24-12-25-26(23,10-13-6-4-3-5-7-13)11-14(17(21)22)8-9-15(18)19/h3-7,14H,2,8-12H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | OQOWUISMBLYVED-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|