C14H20O — CID 22475808
1-ethenyl-3-hexan-3-yloxybenzene (PubChem CID 22475808) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-ethenyl-3-hexan-3-yloxybenzene.
| Compound Name | 1-ethenyl-3-hexan-3-yloxybenzene |
|---|---|
| PubChem CID | 22475808 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-ethenyl-3-hexan-3-yloxybenzene |
| SMILES | C=Cc1cccc(OC(CC)CCC)c1 |
| InChI | InChI=1S/C14H20O/c1-4-8-13(6-3)15-14-10-7-9-12(5-2)11-14/h5,7,9-11,13H,2,4,6,8H2,1,3H3 |
| InChIKey | GDWHIDXYFCXQQB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |