C22H21F2NO4S — CID 22482306
N-[1-[2-(2,4-difluorophenyl)phenyl]ethyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 22482306) has the molecular formula C22H21F2NO4S and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[1-[2-(2,4-difluorophenyl)phenyl]ethyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[1-[2-(2,4-difluorophenyl)phenyl]ethyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 22482306 |
| Molecular Formula | C22H21F2NO4S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[1-[2-(2,4-difluorophenyl)phenyl]ethyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)c2ccccc2-c2ccc(F)cc2F)c(OC)c1 |
| InChI | InChI=1S/C22H21F2NO4S/c1-14(25-30(26,27)22-11-9-16(28-2)13-21(22)29-3)17-6-4-5-7-18(17)19-10-8-15(23)12-20(19)24/h4-14,25H,1-3H3 |
| InChIKey | AKROREHQWBUYTB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |