C22H33N3O4S2 — CID 22495516
N-[4-(butylamino)-1-[(4-methylphenyl)sulfonylamino]butyl]-4-methylbenzenesulfonamide (PubChem CID 22495516) has the molecular formula C22H33N3O4S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is N-[4-(butylamino)-1-[(4-methylphenyl)sulfonylamino]butyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-(butylamino)-1-[(4-methylphenyl)sulfonylamino]butyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 22495516 |
| Molecular Formula | C22H33N3O4S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[4-(butylamino)-1-[(4-methylphenyl)sulfonylamino]butyl]-4-methylbenzenesulfonamide |
| SMILES | CCCCNCCCC(NS(=O)(=O)c1ccc(C)cc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H33N3O4S2/c1-4-5-16-23-17-6-7-22(24-30(26,27)20-12-8-18(2)9-13-20)25-31(28,29)21-14-10-19(3)11-15-21/h8-15,22-25H,4-7,16-17H2,1-3H3 |
| InChIKey | LMVFWSLUAXSNHW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|