C22H26O4S — CID 22504710
2-[4-[4-(2,5-dimethylphenyl)-4-oxobutyl]sulfanyl-2,6-dimethylphenoxy]acetic acid (PubChem CID 22504710) has the molecular formula C22H26O4S and a molecular weight of 386.51 g/mol. Its IUPAC name is 2-[4-[4-(2,5-dimethylphenyl)-4-oxobutyl]sulfanyl-2,6-dimethylphenoxy]acetic acid.
| Compound Name | 2-[4-[4-(2,5-dimethylphenyl)-4-oxobutyl]sulfanyl-2,6-dimethylphenoxy]acetic acid |
|---|---|
| PubChem CID | 22504710 |
| Molecular Formula | C22H26O4S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[4-[4-(2,5-dimethylphenyl)-4-oxobutyl]sulfanyl-2,6-dimethylphenoxy]acetic acid |
| SMILES | Cc1ccc(C)c(C(=O)CCCSc2cc(C)c(OCC(=O)O)c(C)c2)c1 |
| InChI | InChI=1S/C22H26O4S/c1-14-7-8-15(2)19(10-14)20(23)6-5-9-27-18-11-16(3)22(17(4)12-18)26-13-21(24)25/h7-8,10-12H,5-6,9,13H2,1-4H3,(H,24,25) |
| InChIKey | UNUCDZAUBKGNIO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|