C18H16FN3O2S — CID 22515404
2-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide (PubChem CID 22515404) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide.
| Compound Name | 2-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 22515404 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide |
| SMILES | Cc1csc(NC(=O)C(=O)c2cc(C)n(-c3ccccc3F)c2C)n1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-10-9-25-18(20-10)21-17(24)16(23)13-8-11(2)22(12(13)3)15-7-5-4-6-14(15)19/h4-9H,1-3H3,(H,20,21,24) |
| InChIKey | PQWQKROUCTZWQQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|