C20H19FN2O2S — CID 100624803
1-(2-fluorophenyl)-2,5-dimethyl-N-[4-[(S)-methylsulfinyl]phenyl]pyrrole-3-carboxamide (PubChem CID 100624803) has the molecular formula C20H19FN2O2S and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2,5-dimethyl-N-[4-[(S)-methylsulfinyl]phenyl]pyrrole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-2,5-dimethyl-N-[4-[(S)-methylsulfinyl]phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 100624803 |
| Molecular Formula | C20H19FN2O2S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-(2-fluorophenyl)-2,5-dimethyl-N-[4-[(S)-methylsulfinyl]phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc([S@](C)=O)cc2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C20H19FN2O2S/c1-13-12-17(14(2)23(13)19-7-5-4-6-18(19)21)20(24)22-15-8-10-16(11-9-15)26(3)25/h4-12H,1-3H3,(H,22,24)/t26-/m0/s1 |
| InChIKey | ONFNEZZJJSHAJY-SANMLTNESA-N |
| XLogP | 4.22 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|