C20H21N3O2S — CID 22515454
2-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide (PubChem CID 22515454) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide.
| Compound Name | 2-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 22515454 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide |
| SMILES | Cc1csc(NC(=O)C(=O)c2cc(C)n(-c3c(C)cccc3C)c2C)n1 |
| InChI | InChI=1S/C20H21N3O2S/c1-11-7-6-8-12(2)17(11)23-14(4)9-16(15(23)5)18(24)19(25)22-20-21-13(3)10-26-20/h6-10H,1-5H3,(H,21,22,25) |
| InChIKey | ZBCYGAIYMHHVLQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|