C27H38N4O5S — CID 22562510
tert-butyl 4-[5-[5,5-dimethyl-4-oxo-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylideneimidazolidin-1-yl]pentyl]piperazine-1-carboxylate (PubChem CID 22562510) has the molecular formula C27H38N4O5S and a molecular weight of 530.69 g/mol. Its IUPAC name is tert-butyl 4-[5-[5,5-dimethyl-4-oxo-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylideneimidazolidin-1-yl]pentyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[5,5-dimethyl-4-oxo-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylideneimidazolidin-1-yl]pentyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22562510 |
| Molecular Formula | C27H38N4O5S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | tert-butyl 4-[5-[5,5-dimethyl-4-oxo-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylideneimidazolidin-1-yl]pentyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCCCN2C(=S)N(c3ccc4c(c3)COC4=O)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C27H38N4O5S/c1-26(2,3)36-25(34)29-15-13-28(14-16-29)11-7-6-8-12-30-24(37)31(23(33)27(30,4)5)20-9-10-21-19(17-20)18-35-22(21)32/h9-10,17H,6-8,11-16,18H2,1-5H3 |
| InChIKey | YAYIAQMLGGQSHG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|