C31H40N4O4S2 — CID 22562862
5,5-dimethyl-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylidene-1-[8-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]octyl]imidazolidin-4-one (PubChem CID 22562862) has the molecular formula C31H40N4O4S2 and a molecular weight of 596.82 g/mol. Its IUPAC name is 5,5-dimethyl-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylidene-1-[8-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]octyl]imidazolidin-4-one.
| Compound Name | 5,5-dimethyl-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylidene-1-[8-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]octyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 22562862 |
| Molecular Formula | C31H40N4O4S2 |
| Molecular Weight | 596.82 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 5,5-dimethyl-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylidene-1-[8-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]octyl]imidazolidin-4-one |
| SMILES | CC1(C)C(=O)N(c2ccc3c(c2)COC3=O)C(=S)N1CCCCCCCCN1CCN(C(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C31H40N4O4S2/c1-31(2)29(38)35(24-11-12-26-23(20-24)22-39-28(26)37)30(40)34(31)14-8-6-4-3-5-7-13-32-15-17-33(18-16-32)27(36)21-25-10-9-19-41-25/h9-12,19-20H,3-8,13-18,21-22H2,1-2H3 |
| InChIKey | NYXIJTQUOHMWJD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|