C16H18FN7O2S — CID 22563748
8-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-7H-purine-2,6-diamine (PubChem CID 22563748) has the molecular formula C16H18FN7O2S and a molecular weight of 391.43 g/mol. Its IUPAC name is 8-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-7H-purine-2,6-diamine.
| Compound Name | 8-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 22563748 |
| Molecular Formula | C16H18FN7O2S |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 8-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-7H-purine-2,6-diamine |
| SMILES | Nc1nc(N)c2[nH]c(C3CCN(S(=O)(=O)c4ccc(F)cc4)CC3)nc2n1 |
| InChI | InChI=1S/C16H18FN7O2S/c17-10-1-3-11(4-2-10)27(25,26)24-7-5-9(6-8-24)14-20-12-13(18)21-16(19)23-15(12)22-14/h1-4,9H,5-8H2,(H5,18,19,20,21,22,23) |
| InChIKey | IDDPVLBMIGFHIY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |