C17H16F2N4O2S — CID 155902800
2-[1-(3,5-difluorophenyl)sulfonylpiperidin-4-yl]-1H-imidazo[4,5-b]pyridine (PubChem CID 155902800) has the molecular formula C17H16F2N4O2S and a molecular weight of 378.40 g/mol. Its IUPAC name is 2-[1-(3,5-difluorophenyl)sulfonylpiperidin-4-yl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[1-(3,5-difluorophenyl)sulfonylpiperidin-4-yl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 155902800 |
| Molecular Formula | C17H16F2N4O2S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-[1-(3,5-difluorophenyl)sulfonylpiperidin-4-yl]-1H-imidazo[4,5-b]pyridine |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)N1CCC(c2nc3ncccc3[nH]2)CC1 |
| InChI | InChI=1S/C17H16F2N4O2S/c18-12-8-13(19)10-14(9-12)26(24,25)23-6-3-11(4-7-23)16-21-15-2-1-5-20-17(15)22-16/h1-2,5,8-11H,3-4,6-7H2,(H,20,21,22) |
| InChIKey | LWYNKMZGEPRFFU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |