C17H24N4 — CID 75615034
2-[1-(cyclohexylmethyl)pyrrolidin-3-yl]-1H-imidazo[4,5-b]pyridine (PubChem CID 75615034) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-[1-(cyclohexylmethyl)pyrrolidin-3-yl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[1-(cyclohexylmethyl)pyrrolidin-3-yl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 75615034 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-[1-(cyclohexylmethyl)pyrrolidin-3-yl]-1H-imidazo[4,5-b]pyridine |
| SMILES | c1cnc2nc(C3CCN(CC4CCCCC4)C3)[nH]c2c1 |
| InChI | InChI=1S/C17H24N4/c1-2-5-13(6-3-1)11-21-10-8-14(12-21)16-19-15-7-4-9-18-17(15)20-16/h4,7,9,13-14H,1-3,5-6,8,10-12H2,(H,18,19,20) |
| InChIKey | YWZDCCAMBWWCFD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |