C16H9FN2O2 — CID 22586504
4-(3-fluorophenoxy)-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 22586504) has the molecular formula C16H9FN2O2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-(3-fluorophenoxy)-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 22586504 |
| Molecular Formula | C16H9FN2O2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 4-(3-fluorophenoxy)-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Fc1cccc(Oc2ncnc3c2oc2ccccc23)c1 |
| InChI | InChI=1S/C16H9FN2O2/c17-10-4-3-5-11(8-10)20-16-15-14(18-9-19-16)12-6-1-2-7-13(12)21-15/h1-9H |
| InChIKey | DADYYQMOYGQPTG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |