C30H33N3O5S — CID 22588305
N-(4-ethylphenyl)-N'-[4-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanediamide (PubChem CID 22588305) has the molecular formula C30H33N3O5S and a molecular weight of 547.68 g/mol. Its IUPAC name is N-(4-ethylphenyl)-N'-[4-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanediamide.
| Compound Name | N-(4-ethylphenyl)-N'-[4-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanediamide |
|---|---|
| PubChem CID | 22588305 |
| Molecular Formula | C30H33N3O5S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | N-(4-ethylphenyl)-N'-[4-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanediamide |
| SMILES | CCCCCCc1cc2cc(-c3csc(NC(=O)CCC(=O)Nc4ccc(CC)cc4)n3)c(=O)oc2cc1O |
| InChI | InChI=1S/C30H33N3O5S/c1-3-5-6-7-8-20-15-21-16-23(29(37)38-26(21)17-25(20)34)24-18-39-30(32-24)33-28(36)14-13-27(35)31-22-11-9-19(4-2)10-12-22/h9-12,15-18,34H,3-8,13-14H2,1-2H3,(H,31,35)(H,32,33,36) |
| InChIKey | WNGAWOZIMIPGNO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|