C26H28N2O5S — CID 6256819
3-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-6-hexyl-7-hydroxychromen-2-one (PubChem CID 6256819) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is 3-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-6-hexyl-7-hydroxychromen-2-one.
| Compound Name | 3-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-6-hexyl-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 6256819 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 3-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-6-hexyl-7-hydroxychromen-2-one |
| SMILES | CCCCCCc1cc2cc(-c3csc(Nc4cc(OC)ccc4OC)n3)c(=O)oc2cc1O |
| InChI | InChI=1S/C26H28N2O5S/c1-4-5-6-7-8-16-11-17-12-19(25(30)33-24(17)14-22(16)29)21-15-34-26(28-21)27-20-13-18(31-2)9-10-23(20)32-3/h9-15,29H,4-8H2,1-3H3,(H,27,28) |
| InChIKey | RDTLWZNZAJIUTB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|