C26H31NO5 — CID 22613227
3-[5-benzyl-3-(piperidin-1-ylmethyl)-2-propan-2-yloxyphenyl]-2,4-dioxobutanoic acid (PubChem CID 22613227) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[5-benzyl-3-(piperidin-1-ylmethyl)-2-propan-2-yloxyphenyl]-2,4-dioxobutanoic acid.
| Compound Name | 3-[5-benzyl-3-(piperidin-1-ylmethyl)-2-propan-2-yloxyphenyl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 22613227 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 3-[5-benzyl-3-(piperidin-1-ylmethyl)-2-propan-2-yloxyphenyl]-2,4-dioxobutanoic acid |
| SMILES | CC(C)Oc1c(CN2CCCCC2)cc(Cc2ccccc2)cc1C(C=O)C(=O)C(=O)O |
| InChI | InChI=1S/C26H31NO5/c1-18(2)32-25-21(16-27-11-7-4-8-12-27)14-20(13-19-9-5-3-6-10-19)15-22(25)23(17-28)24(29)26(30)31/h3,5-6,9-10,14-15,17-18,23H,4,7-8,11-13,16H2,1-2H3,(H,30,31) |
| InChIKey | QEOIHHQNKYEVEB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|