C8H8N3O3P-2 — CID 22618018
(5-methylpyrazolo[1,5-a]pyrimidin-7-yl)methyl-dioxido-oxo-λ5-phosphane (PubChem CID 22618018) has the molecular formula C8H8N3O3P-2 and a molecular weight of 225.14 g/mol. Its IUPAC name is (5-methylpyrazolo[1,5-a]pyrimidin-7-yl)methyl-dioxido-oxo-λ5-phosphane.
| Compound Name | (5-methylpyrazolo[1,5-a]pyrimidin-7-yl)methyl-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 22618018 |
| Molecular Formula | C8H8N3O3P-2 |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | (5-methylpyrazolo[1,5-a]pyrimidin-7-yl)methyl-dioxido-oxo-λ5-phosphane |
| SMILES | Cc1cc(CP(=O)([O-])[O-])n2nccc2n1 |
| InChI | InChI=1S/C8H10N3O3P/c1-6-4-7(5-15(12,13)14)11-8(10-6)2-3-9-11/h2-4H,5H2,1H3,(H2,12,13,14)/p-2 |
| InChIKey | GAKXSEUNHKKISF-UHFFFAOYSA-L |
| XLogP | -0.55 |
| TPSA | 93.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|