C13H18N3O3PS-2 — CID 22618037
[(5-butylpyrazolo[1,5-a]pyrimidin-7-yl)-ethylsulfanylmethyl]-dioxido-oxo-λ5-phosphane (PubChem CID 22618037) has the molecular formula C13H18N3O3PS-2 and a molecular weight of 327.35 g/mol. Its IUPAC name is [(5-butylpyrazolo[1,5-a]pyrimidin-7-yl)-ethylsulfanylmethyl]-dioxido-oxo-λ5-phosphane.
| Compound Name | [(5-butylpyrazolo[1,5-a]pyrimidin-7-yl)-ethylsulfanylmethyl]-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 22618037 |
| Molecular Formula | C13H18N3O3PS-2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | [(5-butylpyrazolo[1,5-a]pyrimidin-7-yl)-ethylsulfanylmethyl]-dioxido-oxo-λ5-phosphane |
| SMILES | CCCCc1cc(C(SCC)P(=O)([O-])[O-])n2nccc2n1 |
| InChI | InChI=1S/C13H20N3O3PS/c1-3-5-6-10-9-11(13(21-4-2)20(17,18)19)16-12(15-10)7-8-14-16/h7-9,13H,3-6H2,1-2H3,(H2,17,18,19)/p-2 |
| InChIKey | TYCOKECFQJXURV-UHFFFAOYSA-L |
| XLogP | 1.74 |
| TPSA | 93.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|