C14H20N3O3PS-2 — CID 22617987
(5-hexylpyrazolo[1,5-a]pyrimidin-7-yl)methylsulfanylmethyl-dioxido-oxo-λ5-phosphane (PubChem CID 22617987) has the molecular formula C14H20N3O3PS-2 and a molecular weight of 341.37 g/mol. Its IUPAC name is (5-hexylpyrazolo[1,5-a]pyrimidin-7-yl)methylsulfanylmethyl-dioxido-oxo-λ5-phosphane.
| Compound Name | (5-hexylpyrazolo[1,5-a]pyrimidin-7-yl)methylsulfanylmethyl-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 22617987 |
| Molecular Formula | C14H20N3O3PS-2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (5-hexylpyrazolo[1,5-a]pyrimidin-7-yl)methylsulfanylmethyl-dioxido-oxo-λ5-phosphane |
| SMILES | CCCCCCc1cc(CSCP(=O)([O-])[O-])n2nccc2n1 |
| InChI | InChI=1S/C14H22N3O3PS/c1-2-3-4-5-6-12-9-13(10-22-11-21(18,19)20)17-14(16-12)7-8-15-17/h7-9H,2-6,10-11H2,1H3,(H2,18,19,20)/p-2 |
| InChIKey | VLGCZPATYLFYBO-UHFFFAOYSA-L |
| XLogP | 1.96 |
| TPSA | 93.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|