C12H16N3O3PS-2 — CID 22617997
(5-butylpyrazolo[1,5-a]pyrimidin-7-yl)methylsulfanylmethyl-dioxido-oxo-λ5-phosphane (PubChem CID 22617997) has the molecular formula C12H16N3O3PS-2 and a molecular weight of 313.32 g/mol. Its IUPAC name is (5-butylpyrazolo[1,5-a]pyrimidin-7-yl)methylsulfanylmethyl-dioxido-oxo-λ5-phosphane.
| Compound Name | (5-butylpyrazolo[1,5-a]pyrimidin-7-yl)methylsulfanylmethyl-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 22617997 |
| Molecular Formula | C12H16N3O3PS-2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (5-butylpyrazolo[1,5-a]pyrimidin-7-yl)methylsulfanylmethyl-dioxido-oxo-λ5-phosphane |
| SMILES | CCCCc1cc(CSCP(=O)([O-])[O-])n2nccc2n1 |
| InChI | InChI=1S/C12H18N3O3PS/c1-2-3-4-10-7-11(8-20-9-19(16,17)18)15-12(14-10)5-6-13-15/h5-7H,2-4,8-9H2,1H3,(H2,16,17,18)/p-2 |
| InChIKey | WVGBPTWYXJNWDF-UHFFFAOYSA-L |
| XLogP | 1.18 |
| TPSA | 93.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|