C12H8ClF3O4 — CID 22639050
6-chloro-8-formyl-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 22639050) has the molecular formula C12H8ClF3O4 and a molecular weight of 308.64 g/mol. Its IUPAC name is 6-chloro-8-formyl-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-formyl-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 22639050 |
| Molecular Formula | C12H8ClF3O4 |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 6-chloro-8-formyl-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=Cc1cc(Cl)cc2c1OC(C(F)(F)F)C(C(=O)O)C2 |
| InChI | InChI=1S/C12H8ClF3O4/c13-7-1-5-3-8(11(18)19)10(12(14,15)16)20-9(5)6(2-7)4-17/h1-2,4,8,10H,3H2,(H,18,19) |
| InChIKey | MJFDFAVBLHFJQB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|