C16H18ClN3O2 — CID 22639995
4-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-2-prop-2-enoxyphenol (PubChem CID 22639995) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 4-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-2-prop-2-enoxyphenol.
| Compound Name | 4-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-2-prop-2-enoxyphenol |
|---|---|
| PubChem CID | 22639995 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-2-prop-2-enoxyphenol |
| SMILES | C=CCOc1cc(CNc2nc(C)nc(C)c2Cl)ccc1O |
| InChI | InChI=1S/C16H18ClN3O2/c1-4-7-22-14-8-12(5-6-13(14)21)9-18-16-15(17)10(2)19-11(3)20-16/h4-6,8,21H,1,7,9H2,2-3H3,(H,18,19,20) |
| InChIKey | UOTHWXMZAWAZIO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|