C13H14N2O2 — CID 22663976
6-amino-1,2,3,4-tetrahydrocarbazole-9-carboxylic acid (PubChem CID 22663976) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 6-amino-1,2,3,4-tetrahydrocarbazole-9-carboxylic acid.
| Compound Name | 6-amino-1,2,3,4-tetrahydrocarbazole-9-carboxylic acid |
|---|---|
| PubChem CID | 22663976 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 6-amino-1,2,3,4-tetrahydrocarbazole-9-carboxylic acid |
| SMILES | Nc1ccc2c(c1)c1c(n2C(=O)O)CCCC1 |
| InChI | InChI=1S/C13H14N2O2/c14-8-5-6-12-10(7-8)9-3-1-2-4-11(9)15(12)13(16)17/h5-7H,1-4,14H2,(H,16,17) |
| InChIKey | KDUAPBNFRBNYDM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|