C17H19NO7S2 — CID 22671829
4-methylsulfonyloxy-1-naphthalen-2-ylsulfonylpiperidine-3-carboxylic acid (PubChem CID 22671829) has the molecular formula C17H19NO7S2 and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-methylsulfonyloxy-1-naphthalen-2-ylsulfonylpiperidine-3-carboxylic acid.
| Compound Name | 4-methylsulfonyloxy-1-naphthalen-2-ylsulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 22671829 |
| Molecular Formula | C17H19NO7S2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-methylsulfonyloxy-1-naphthalen-2-ylsulfonylpiperidine-3-carboxylic acid |
| SMILES | CS(=O)(=O)OC1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1C(=O)O |
| InChI | InChI=1S/C17H19NO7S2/c1-26(21,22)25-16-8-9-18(11-15(16)17(19)20)27(23,24)14-7-6-12-4-2-3-5-13(12)10-14/h2-7,10,15-16H,8-9,11H2,1H3,(H,19,20) |
| InChIKey | DIZQGTRZPNCQOY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|