C10H12N3O3PS2 — CID 2268
3-(dimethoxyphosphinothioylsulfanylmethyl)-1,2,3-benzotriazin-4-one (PubChem CID 2268) has the molecular formula C10H12N3O3PS2 and a molecular weight of 317.33 g/mol. Its IUPAC name is 3-(dimethoxyphosphinothioylsulfanylmethyl)-1,2,3-benzotriazin-4-one.
| Compound Name | 3-(dimethoxyphosphinothioylsulfanylmethyl)-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 2268 |
| Molecular Formula | C10H12N3O3PS2 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 3-(dimethoxyphosphinothioylsulfanylmethyl)-1,2,3-benzotriazin-4-one |
| SMILES | COP(=S)(OC)SCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C10H12N3O3PS2/c1-15-17(18,16-2)19-7-13-10(14)8-5-3-4-6-9(8)11-12-13/h3-6H,7H2,1-2H3 |
| InChIKey | CJJOSEISRRTUQB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|