C22H20N4O3S — CID 22693350
ethyl 2-[[2-(6-aminoindazol-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 22693350) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is ethyl 2-[[2-(6-aminoindazol-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(6-aminoindazol-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 22693350 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | ethyl 2-[[2-(6-aminoindazol-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)Cn1ncc2ccc(N)cc21 |
| InChI | InChI=1S/C22H20N4O3S/c1-2-29-22(28)20-17(14-6-4-3-5-7-14)13-30-21(20)25-19(27)12-26-18-10-16(23)9-8-15(18)11-24-26/h3-11,13H,2,12,23H2,1H3,(H,25,27) |
| InChIKey | FWSODLUCLYDGLI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|