C22H24N6O5S2 — CID 22709627
4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]-N-methyl-1-(3,4,5,6-tetrahydro-1H-[1,3]oxazolo[5,4-c]pyridazine-2-carbonyl)piperazine-2-carboxamide (PubChem CID 22709627) has the molecular formula C22H24N6O5S2 and a molecular weight of 516.61 g/mol. Its IUPAC name is 4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]-N-methyl-1-(3,4,5,6-tetrahydro-1H-[1,3]oxazolo[5,4-c]pyridazine-2-carbonyl)piperazine-2-carboxamide.
| Compound Name | 4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]-N-methyl-1-(3,4,5,6-tetrahydro-1H-[1,3]oxazolo[5,4-c]pyridazine-2-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 22709627 |
| Molecular Formula | C22H24N6O5S2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]-N-methyl-1-(3,4,5,6-tetrahydro-1H-[1,3]oxazolo[5,4-c]pyridazine-2-carbonyl)piperazine-2-carboxamide |
| SMILES | C#Cc1ccc2cc(S(=O)(=O)N3CCN(C(=O)N4CCC5=C(N4)OCN5)C(C(=O)NC)C3)sc2c1 |
| InChI | InChI=1S/C22H24N6O5S2/c1-3-14-4-5-15-11-19(34-18(15)10-14)35(31,32)26-8-9-27(17(12-26)20(29)23-2)22(30)28-7-6-16-21(25-28)33-13-24-16/h1,4-5,10-11,17,24-25H,6-9,12-13H2,2H3,(H,23,29) |
| InChIKey | RFFXBLJOBYDEFK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|